CAS 124937-85-5 appears in our catalog under these names: 3-(2-Methoxy-5-methylphenyl)-3-phenylpropyl 4-methylbenzenesulfonate, 95%, 95%, 3-(2-Methoxy-5-methylphenyl)-3-phenylpropyl 4-methylbenzenesulfonate, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
[3-(2-methoxy-5-methylphenyl)-3-phenylpropyl] 4-methylbenzenesulfonate (CAS 124937-85-5) is a chemical compound with the molecular formula C24H26O4S and a molecular weight of 410.5 g/mol. IUPAC name: [3-(2-methoxy-5-methylphenyl)-3-phenylpropyl] 4-methylbenzenesulfonate. InChIKey: XFMJXASCGLTHSN-UHFFFAOYSA-N.
| Molecular formula | C24H26O4S |
|---|---|
| Molecular weight | 410.5 g/mol |
| IUPAC name | [3-(2-methoxy-5-methylphenyl)-3-phenylpropyl] 4-methylbenzenesulfonate |
| InChIKey | XFMJXASCGLTHSN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCC(C2=CC=CC=C2)C3=C(C=CC(=C3)C)OC |
Computed by PubChem (NCBI)