CAS 1249381-64-3 is the registry number for 1-(2,3-Difluorophenyl)guanidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,3-difluorophenyl)guanidine (CAS 1249381-64-3) is a chemical compound with the molecular formula C7H7F2N3 and a molecular weight of 171.15 g/mol. IUPAC name: 2-(2,3-difluorophenyl)guanidine. InChIKey: OKEOWPPTBWDXHF-UHFFFAOYSA-N.
| Molecular formula | C7H7F2N3 |
|---|---|
| Molecular weight | 171.15 g/mol |
| IUPAC name | 2-(2,3-difluorophenyl)guanidine |
| InChIKey | OKEOWPPTBWDXHF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)N=C(N)N |
Computed by PubChem (NCBI)