CAS 1249397-70-3 appears in our catalog under these names: 5-(Chloromethyl)-3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazole, 5-(Chloromethyl)-3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazole, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
5-(chloromethyl)-3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazole (CAS 1249397-70-3) is a chemical compound with the molecular formula C5H4ClF3N2O and a molecular weight of 200.54 g/mol. IUPAC name: 5-(chloromethyl)-3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazole. InChIKey: MXDUEINIDPAOHK-UHFFFAOYSA-N.
| Molecular formula | C5H4ClF3N2O |
|---|---|
| Molecular weight | 200.54 g/mol |
| IUPAC name | 5-(chloromethyl)-3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazole |
| InChIKey | MXDUEINIDPAOHK-UHFFFAOYSA-N |
| SMILES | C(C1=NOC(=N1)CCl)C(F)(F)F |
Computed by PubChem (NCBI)