Products 1249427-02-8
CAS 1249427-02-8 is the registry number for 4-Iodo-α-(4-methylphenyl)benzenemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
(4-iodophenyl)-(4-methylphenyl)methanol (CAS 1249427-02-8) is a chemical compound with the molecular formula C14H13IO and a molecular weight of 324.16 g/mol. IUPAC name: (4-iodophenyl)-(4-methylphenyl)methanol. InChIKey: XNPVSCBKXUSSOV-UHFFFAOYSA-N.
| Molecular formula | C14H13IO |
|---|---|
| Molecular weight | 324.16 g/mol |
| IUPAC name | (4-iodophenyl)-(4-methylphenyl)methanol |
| InChIKey | XNPVSCBKXUSSOV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C2=CC=C(C=C2)I)O |
Computed by PubChem (NCBI)