CAS 1249453-35-7 appears in our catalog under these names: (4-Chloro-2-fluorophenyl)thiourea, 95%, (4-Chloro-2-fluorophenyl)thiourea. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 250mg, 2,5g.
(4-chloro-2-fluorophenyl)thiourea (CAS 1249453-35-7) is a chemical compound with the molecular formula C7H6ClFN2S and a molecular weight of 204.65 g/mol. IUPAC name: (4-chloro-2-fluorophenyl)thiourea. InChIKey: KDVKVMLGEXQVIC-UHFFFAOYSA-N.
| Molecular formula | C7H6ClFN2S |
|---|---|
| Molecular weight | 204.65 g/mol |
| IUPAC name | (4-chloro-2-fluorophenyl)thiourea |
| InChIKey | KDVKVMLGEXQVIC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)F)NC(=S)N |
Computed by PubChem (NCBI)