CAS 124951-96-8 is the registry number for Amppd disodium salt, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Disodium;[3-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)phenyl] phosphate (CAS 124951-96-8) is a chemical compound with the molecular formula C18H21Na2O7P and a molecular weight of 426.3 g/mol. IUPAC name: disodium;[3-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)phenyl] phosphate. InChIKey: YADDZULXACVKHE-UHFFFAOYSA-L.
| Molecular formula | C18H21Na2O7P |
|---|---|
| Molecular weight | 426.3 g/mol |
| IUPAC name | disodium;[3-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)phenyl] phosphate |
| InChIKey | YADDZULXACVKHE-UHFFFAOYSA-L |
| SMILES | COC1(C2(C3CC4CC(C3)CC2C4)OO1)C5=CC(=CC=C5)OP(=O)([O-])[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)