CAS 1249569-04-7 is the registry number for 1-(5-(Trifluoromethyl)pyridin-2-yl)-1H-1,2,4-triazol-5-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-[5-(trifluoromethyl)-2-pyridinyl]-1,2,4-triazol-3-amine (CAS 1249569-04-7) is a chemical compound with the molecular formula C8H6F3N5 and a molecular weight of 229.16 g/mol. IUPAC name: 2-[5-(trifluoromethyl)-2-pyridinyl]-1,2,4-triazol-3-amine. InChIKey: QLRSMRMTVUGXRJ-UHFFFAOYSA-N.
| Molecular formula | C8H6F3N5 |
|---|---|
| Molecular weight | 229.16 g/mol |
| IUPAC name | 2-[5-(trifluoromethyl)-2-pyridinyl]-1,2,4-triazol-3-amine |
| InChIKey | QLRSMRMTVUGXRJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(F)(F)F)N2C(=NC=N2)N |
Computed by PubChem (NCBI)