CAS 1249781-75-6 appears in our catalog under these names: 7-Chloro-5-fluoro-1,3-benzoxazole-2-thiol, 95%, 7-Chloro-5-fluoro-1,3-benzoxazole-2-thiol. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 100mg, 1g.
7-chloro-5-fluoro-3H-1,3-benzoxazole-2-thione (CAS 1249781-75-6) is a chemical compound with the molecular formula C7H3ClFNOS and a molecular weight of 203.62 g/mol. IUPAC name: 7-chloro-5-fluoro-3H-1,3-benzoxazole-2-thione. InChIKey: VDYXZRRIZKZXBI-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNOS |
|---|---|
| Molecular weight | 203.62 g/mol |
| IUPAC name | 7-chloro-5-fluoro-3H-1,3-benzoxazole-2-thione |
| InChIKey | VDYXZRRIZKZXBI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC(=S)O2)Cl)F |
Computed by PubChem (NCBI)