CAS 1249836-00-7 appears in our catalog under these names: 5,7-Dimethyl-1,3-benzoxazol-2-amine, 95%, 5,7-Dimethyl-1,3-benzoxazol-2-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
5,7-dimethyl-1,3-benzoxazol-2-amine (CAS 1249836-00-7) is a chemical compound with the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. IUPAC name: 5,7-dimethyl-1,3-benzoxazol-2-amine. InChIKey: QOTCULOVLLBLDH-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O |
|---|---|
| Molecular weight | 162.19 g/mol |
| IUPAC name | 5,7-dimethyl-1,3-benzoxazol-2-amine |
| InChIKey | QOTCULOVLLBLDH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)N=C(O2)N)C |
Computed by PubChem (NCBI)