Products 1249876-27-4
CAS 1249876-27-4 is the registry number for 1-[(3-Iodophenyl)carbamoyl]cyclopropane-1-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-[(3-iodophenyl)carbamoyl]cyclopropane-1-carboxylic acid (CAS 1249876-27-4) is a chemical compound with the molecular formula C11H10INO3 and a molecular weight of 331.11 g/mol. IUPAC name: 1-[(3-iodophenyl)carbamoyl]cyclopropane-1-carboxylic acid. InChIKey: JKWJQPPAJTXDGZ-UHFFFAOYSA-N.
| Molecular formula | C11H10INO3 |
|---|---|
| Molecular weight | 331.11 g/mol |
| IUPAC name | 1-[(3-iodophenyl)carbamoyl]cyclopropane-1-carboxylic acid |
| InChIKey | JKWJQPPAJTXDGZ-UHFFFAOYSA-N |
| SMILES | C1CC1(C(=O)NC2=CC(=CC=C2)I)C(=O)O |
Computed by PubChem (NCBI)