CAS 1249907-95-6 is the registry number for 3-Chloro-5-(trifluoromethyl)pyridine-2-sulfonamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-chloro-5-(trifluoromethyl)pyridine-2-sulfonamide (CAS 1249907-95-6) is a chemical compound with the molecular formula C6H4ClF3N2O2S and a molecular weight of 260.62 g/mol. IUPAC name: 3-chloro-5-(trifluoromethyl)pyridine-2-sulfonamide. InChIKey: YIEPIPKIRQJPDY-UHFFFAOYSA-N.
| Molecular formula | C6H4ClF3N2O2S |
|---|---|
| Molecular weight | 260.62 g/mol |
| IUPAC name | 3-chloro-5-(trifluoromethyl)pyridine-2-sulfonamide |
| InChIKey | YIEPIPKIRQJPDY-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)S(=O)(=O)N)C(F)(F)F |
Computed by PubChem (NCBI)