Products 1249916-50-4
CAS 1249916-50-4 is the registry number for 5-Amino-n-(2-hydroxyethyl)-n,2-dimethylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-amino-N-(2-hydroxyethyl)-N,2-dimethylbenzamide (CAS 1249916-50-4) is a chemical compound with the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. IUPAC name: 5-amino-N-(2-hydroxyethyl)-N,2-dimethylbenzamide. InChIKey: UZLNPTAZNGBOFU-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | 5-amino-N-(2-hydroxyethyl)-N,2-dimethylbenzamide |
| InChIKey | UZLNPTAZNGBOFU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N)C(=O)N(C)CCO |
Computed by PubChem (NCBI)