Products 1249945-88-7

CAS 1249945-88-7 is the registry number for 5-Ethyl-4-iodo-1-methyl-1h-pyrazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

5-ethyl-4-iodo-1-methylpyrazole-3-carboxylic acid (CAS 1249945-88-7) is a chemical compound with the molecular formula C7H9IN2O2 and a molecular weight of 280.06 g/mol. IUPAC name: 5-ethyl-4-iodo-1-methylpyrazole-3-carboxylic acid. InChIKey: VFFVYJJPSAKJMZ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9IN2O2
Molecular weight280.06 g/mol
IUPAC name5-ethyl-4-iodo-1-methylpyrazole-3-carboxylic acid
InChIKeyVFFVYJJPSAKJMZ-UHFFFAOYSA-N
SMILESCCC1=C(C(=NN1C)C(=O)O)I

Computed by PubChem (NCBI)