Products 124999-47-9

CAS 124999-47-9 is the registry number for Methyl 5-chloropyrimidine-4-carboxylate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 5-chloropyrimidine-4-carboxylate (CAS 124999-47-9) is a chemical compound with the molecular formula C6H5ClN2O2 and a molecular weight of 172.57 g/mol. IUPAC name: methyl 5-chloropyrimidine-4-carboxylate. InChIKey: YQNDTRSJLOUIBN-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5ClN2O2
Molecular weight172.57 g/mol
IUPAC namemethyl 5-chloropyrimidine-4-carboxylate
InChIKeyYQNDTRSJLOUIBN-UHFFFAOYSA-N
SMILESCOC(=O)C1=NC=NC=C1Cl

Computed by PubChem (NCBI)