CAS 125-31-5 appears in our catalog under these names: Xylenolblue, p.a., 5 g, glass, P-Xylenol blue, 98+%, Xylenol blue, p-Xylenol Blue, >95.0%(HPLC), Xylenol blue, 95.25%. Offered by: Roth, AmBeed, Chemat, Biosynth, TCI. Available pack sizes: 5g, 1g, 10g, 25g, 100g, 50g, 250g, 500g.
4-[3-(4-hydroxy-2,5-dimethylphenyl)-1,1-dioxo-2,1lambda6-benzoxathiol-3-yl]-2,5-dimethylphenol (CAS 125-31-5) is a chemical compound with the molecular formula C23H22O5S and a molecular weight of 410.5 g/mol. IUPAC name: 4-[3-(4-hydroxy-2,5-dimethylphenyl)-1,1-dioxo-2,1lambda6-benzoxathiol-3-yl]-2,5-dimethylphenol. InChIKey: MGUKYHHAGPFJMC-UHFFFAOYSA-N.
| Molecular formula | C23H22O5S |
|---|---|
| Molecular weight | 410.5 g/mol |
| IUPAC name | 4-[3-(4-hydroxy-2,5-dimethylphenyl)-1,1-dioxo-2,1lambda6-benzoxathiol-3-yl]-2,5-dimethylphenol |
| InChIKey | MGUKYHHAGPFJMC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1O)C)C2(C3=CC=CC=C3S(=O)(=O)O2)C4=C(C=C(C(=C4)C)O)C |
Computed by PubChem (NCBI)