CAS 125-51-9 appears in our catalog under these names: Piptalake, Pipenzolate Bromide, Pipenzolate (bromide). Offered by: TRC, LoGiCal, MedChemExpress. Available pack sizes: 500mg, 10mg, Get quote.
(1-ethyl-1-methylpiperidin-1-ium-3-yl) 2-hydroxy-2,2-diphenylacetate bromide (CAS 125-51-9) is a chemical compound with the molecular formula C22H28BrNO3 and a molecular weight of 434.4 g/mol. IUPAC name: (1-ethyl-1-methylpiperidin-1-ium-3-yl) 2-hydroxy-2,2-diphenylacetate bromide. InChIKey: XEDCWWFPZMHXCM-UHFFFAOYSA-M.
| Molecular formula | C22H28BrNO3 |
|---|---|
| Molecular weight | 434.4 g/mol |
| IUPAC name | (1-ethyl-1-methylpiperidin-1-ium-3-yl) 2-hydroxy-2,2-diphenylacetate bromide |
| InChIKey | XEDCWWFPZMHXCM-UHFFFAOYSA-M |
| SMILES | CC[N+]1(CCCC(C1)OC(=O)C(C2=CC=CC=C2)(C3=CC=CC=C3)O)C.[Br-] |
Computed by PubChem (NCBI)