CAS 125-68-8 appears in our catalog under these names: Levomethorphan Hydrobromide (1mg/ml in Acetonitrile), Levomethorphan Hydrobromide, >95% (HPLC). Offered by: TRC. Available pack sizes: 1x1ml, 10mg, 2,5mg, 5mg.
(1R,9R,10R)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene;hydrobromide (CAS 125-68-8) is a chemical compound with the molecular formula C18H26BrNO and a molecular weight of 352.3 g/mol. IUPAC name: (1R,9R,10R)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene;hydrobromide. InChIKey: MISZALMBODQYFT-FLCXFYETSA-N.
| Molecular formula | C18H26BrNO |
|---|---|
| Molecular weight | 352.3 g/mol |
| IUPAC name | (1R,9R,10R)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene;hydrobromide |
| InChIKey | MISZALMBODQYFT-FLCXFYETSA-N |
| SMILES | CN1CC[C@]23CCCC[C@H]2[C@H]1CC4=C3C=C(C=C4)OC.Br |
Computed by PubChem (NCBI)