CAS 125-71-3 appears in our catalog under these names: Dextromethorphan, Dextromethorphan, >95% (HPLC), Dextromethorphan, 1mg/ml in Methanol, Dextromethorphan (CRM), Dextromethorphan, min. 95 %, 500 mg. Offered by: Hubei YoungXin, TRC, Lipomed, GLPBio, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 2,5g, 250mg, 1ml.
(1S,9S,10S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene (CAS 125-71-3) is a chemical compound with the molecular formula C18H25NO and a molecular weight of 271.4 g/mol. IUPAC name: (1S,9S,10S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene. InChIKey: MKXZASYAUGDDCJ-NJAFHUGGSA-N.
| Molecular formula | C18H25NO |
|---|---|
| Molecular weight | 271.4 g/mol |
| IUPAC name | (1S,9S,10S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
| InChIKey | MKXZASYAUGDDCJ-NJAFHUGGSA-N |
| SMILES | CN1CC[C@@]23CCCC[C@@H]2[C@@H]1CC4=C3C=C(C=C4)OC |
Computed by PubChem (NCBI)