Products 1250007-16-9

CAS 1250007-16-9 is the registry number for Propan-2-yl 3-hydroxypiperidine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

Propan-2-yl 3-hydroxypiperidine-1-carboxylate (CAS 1250007-16-9) is a chemical compound with the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. IUPAC name: propan-2-yl 3-hydroxypiperidine-1-carboxylate. InChIKey: GCHHDBCXGJEKER-UHFFFAOYSA-N.

Identity
Molecular formulaC9H17NO3
Molecular weight187.24 g/mol
IUPAC namepropan-2-yl 3-hydroxypiperidine-1-carboxylate
InChIKeyGCHHDBCXGJEKER-UHFFFAOYSA-N
SMILESCC(C)OC(=O)N1CCCC(C1)O

Computed by PubChem (NCBI)