CAS 1250022-39-9 appears in our catalog under these names: 4-Bromo-2-(1-bromo-2,2,2-trifluoroethyl)-1-methoxybenzene, 95%, 4-Bromo-2-(1-bromo-2,2,2-trifluoroethyl)-1-methoxybenzene. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
4-bromo-2-(1-bromo-2,2,2-trifluoroethyl)-1-methoxybenzene (CAS 1250022-39-9) is a chemical compound with the molecular formula C9H7Br2F3O and a molecular weight of 347.95 g/mol. IUPAC name: 4-bromo-2-(1-bromo-2,2,2-trifluoroethyl)-1-methoxybenzene. InChIKey: OVURZWOXRAOROQ-UHFFFAOYSA-N.
| Molecular formula | C9H7Br2F3O |
|---|---|
| Molecular weight | 347.95 g/mol |
| IUPAC name | 4-bromo-2-(1-bromo-2,2,2-trifluoroethyl)-1-methoxybenzene |
| InChIKey | OVURZWOXRAOROQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Br)C(C(F)(F)F)Br |
Computed by PubChem (NCBI)