CAS 1250073-44-9 appears in our catalog under these names: 1,1-Dioxothiane-4-sulfonamide, 95%, 1,1-Dioxothiane-4-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg, 50mg, 250mg, 500mg, 1000mg.
1,1-dioxothiane-4-sulfonamide (CAS 1250073-44-9) is a chemical compound with the molecular formula C5H11NO4S2 and a molecular weight of 213.3 g/mol. IUPAC name: 1,1-dioxothiane-4-sulfonamide. InChIKey: JMFNEDGXMKPKKZ-UHFFFAOYSA-N.
| Molecular formula | C5H11NO4S2 |
|---|---|
| Molecular weight | 213.3 g/mol |
| IUPAC name | 1,1-dioxothiane-4-sulfonamide |
| InChIKey | JMFNEDGXMKPKKZ-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCC1S(=O)(=O)N |
Computed by PubChem (NCBI)