CAS 1250182-67-2 appears in our catalog under these names: 2,2,2-Trifluoro-1-(trimethyl-1H-pyrazol-4-yl)ethan-1-ol, 95%, 2,2,2-Trifluoro-1-(trimethyl-1H-pyrazol-4-yl)ethan-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,2,2-trifluoro-1-(1,3,5-trimethylpyrazol-4-yl)ethanol (CAS 1250182-67-2) is a chemical compound with the molecular formula C8H11F3N2O and a molecular weight of 208.18 g/mol. IUPAC name: 2,2,2-trifluoro-1-(1,3,5-trimethylpyrazol-4-yl)ethanol. InChIKey: VRIONNHWZSTHSG-UHFFFAOYSA-N.
| Molecular formula | C8H11F3N2O |
|---|---|
| Molecular weight | 208.18 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(1,3,5-trimethylpyrazol-4-yl)ethanol |
| InChIKey | VRIONNHWZSTHSG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C)C)C(C(F)(F)F)O |
Computed by PubChem (NCBI)