Products 1250313-15-5
CAS 1250313-15-5 is the registry number for 3-Amino-4-chloro-N-(2,2-dimethylpropyl)benzamide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-amino-4-chloro-N-(2,2-dimethylpropyl)benzamide (CAS 1250313-15-5) is a chemical compound with the molecular formula C12H17ClN2O and a molecular weight of 240.73 g/mol. IUPAC name: 3-amino-4-chloro-N-(2,2-dimethylpropyl)benzamide. InChIKey: VYUALZYOEHNFNJ-UHFFFAOYSA-N.
| Molecular formula | C12H17ClN2O |
|---|---|
| Molecular weight | 240.73 g/mol |
| IUPAC name | 3-amino-4-chloro-N-(2,2-dimethylpropyl)benzamide |
| InChIKey | VYUALZYOEHNFNJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CNC(=O)C1=CC(=C(C=C1)Cl)N |
Computed by PubChem (NCBI)