CAS 1250382-96-7 appears in our catalog under these names: 4,4,4-Trifluoro-1-phenylbutan-2-amine, 95%, 4,4,4-Trifluoro-1-phenylbutan-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4,4,4-trifluoro-1-phenylbutan-2-amine (CAS 1250382-96-7) is a chemical compound with the molecular formula C10H12F3N and a molecular weight of 203.20 g/mol. IUPAC name: 4,4,4-trifluoro-1-phenylbutan-2-amine. InChIKey: KHJXKGANEWGIFN-UHFFFAOYSA-N.
| Molecular formula | C10H12F3N |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | 4,4,4-trifluoro-1-phenylbutan-2-amine |
| InChIKey | KHJXKGANEWGIFN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(CC(F)(F)F)N |
Computed by PubChem (NCBI)