CAS 1250505-39-5 is the registry number for 4-Pivaloylpiperazin-2-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2,2-dimethylpropanoyl)piperazin-2-one (CAS 1250505-39-5) is a chemical compound with the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. IUPAC name: 4-(2,2-dimethylpropanoyl)piperazin-2-one. InChIKey: GJOJVQKTFVKTNL-UHFFFAOYSA-N.
| Molecular formula | C9H16N2O2 |
|---|---|
| Molecular weight | 184.24 g/mol |
| IUPAC name | 4-(2,2-dimethylpropanoyl)piperazin-2-one |
| InChIKey | GJOJVQKTFVKTNL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)N1CCNC(=O)C1 |
Computed by PubChem (NCBI)