CAS 1250554-02-9 is the registry number for 5-Bromo-2-chloro-7-fluorobenzo[d]oxazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-2-chloro-7-fluoro-1,3-benzoxazole (CAS 1250554-02-9) is a chemical compound with the molecular formula C7H2BrClFNO and a molecular weight of 250.45 g/mol. IUPAC name: 5-bromo-2-chloro-7-fluoro-1,3-benzoxazole. InChIKey: WMJIHUSXBDHXLO-UHFFFAOYSA-N.
| Molecular formula | C7H2BrClFNO |
|---|---|
| Molecular weight | 250.45 g/mol |
| IUPAC name | 5-bromo-2-chloro-7-fluoro-1,3-benzoxazole |
| InChIKey | WMJIHUSXBDHXLO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1N=C(O2)Cl)F)Br |
Computed by PubChem (NCBI)