CAS 1250603-22-5 appears in our catalog under these names: 2-(4-Bromothiophen-2-yl)-2-[(2,2,2-trifluoroethyl)amino]acetic acid, 95%, 2-(4-Bromothiophen-2-yl)-2-((2,2,2-trifluoroethyl)amino)acetic acid, 95%, 2-(4-Bromothiophen-2-yl)-2-((2,2,2-trifluoroethyl)amino)acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 100mg.
2-(4-bromothiophen-2-yl)-2-(2,2,2-trifluoroethylamino)acetic acid (CAS 1250603-22-5) is a chemical compound with the molecular formula C8H7BrF3NO2S and a molecular weight of 318.11 g/mol. IUPAC name: 2-(4-bromothiophen-2-yl)-2-(2,2,2-trifluoroethylamino)acetic acid. InChIKey: SELWXVQTLWAOJS-UHFFFAOYSA-N.
| Molecular formula | C8H7BrF3NO2S |
|---|---|
| Molecular weight | 318.11 g/mol |
| IUPAC name | 2-(4-bromothiophen-2-yl)-2-(2,2,2-trifluoroethylamino)acetic acid |
| InChIKey | SELWXVQTLWAOJS-UHFFFAOYSA-N |
| SMILES | C1=C(SC=C1Br)C(C(=O)O)NCC(F)(F)F |
Computed by PubChem (NCBI)