Products 1250608-12-8
CAS 1250608-12-8 is the registry number for 1-(4-Bromophenyl)-3,3-dimethylbutan-1-ol. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-(4-bromophenyl)-3,3-dimethylbutan-1-ol (CAS 1250608-12-8) is a chemical compound with the molecular formula C12H17BrO and a molecular weight of 257.17 g/mol. IUPAC name: 1-(4-bromophenyl)-3,3-dimethylbutan-1-ol. InChIKey: VMEIUKZONFDIJY-UHFFFAOYSA-N.
| Molecular formula | C12H17BrO |
|---|---|
| Molecular weight | 257.17 g/mol |
| IUPAC name | 1-(4-bromophenyl)-3,3-dimethylbutan-1-ol |
| InChIKey | VMEIUKZONFDIJY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(C1=CC=C(C=C1)Br)O |
Computed by PubChem (NCBI)