Products 1250609-07-4

CAS 1250609-07-4 is the registry number for 5-(Azidomethyl)furan-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-(azidomethyl)furan-2-carboxylic acid (CAS 1250609-07-4) is a chemical compound with the molecular formula C6H5N3O3 and a molecular weight of 167.12 g/mol. IUPAC name: 5-(azidomethyl)furan-2-carboxylic acid. InChIKey: NIIXHKOGJUSUTI-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5N3O3
Molecular weight167.12 g/mol
IUPAC name5-(azidomethyl)furan-2-carboxylic acid
InChIKeyNIIXHKOGJUSUTI-UHFFFAOYSA-N
SMILESC1=C(OC(=C1)C(=O)O)CN=[N+]=[N-]

Computed by PubChem (NCBI)