CAS 1250699-72-9 is the registry number for 5-Bromo-2-chloropyridine-3-sulfonamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-bromo-2-chloropyridine-3-sulfonamide (CAS 1250699-72-9) is a chemical compound with the molecular formula C5H4BrClN2O2S and a molecular weight of 271.52 g/mol. IUPAC name: 5-bromo-2-chloropyridine-3-sulfonamide. InChIKey: VCJIBCGLYQFTIK-UHFFFAOYSA-N.
| Molecular formula | C5H4BrClN2O2S |
|---|---|
| Molecular weight | 271.52 g/mol |
| IUPAC name | 5-bromo-2-chloropyridine-3-sulfonamide |
| InChIKey | VCJIBCGLYQFTIK-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1S(=O)(=O)N)Cl)Br |
Computed by PubChem (NCBI)