CAS 1250810-28-6 appears in our catalog under these names: 2–Amino–5–fluoro–3–methoxy–benzoic acid, 2-Amino-5-fluoro-3-methoxy-benzoic acid, 2-Amino-5-fluoro-3-methoxybenzoic acid, 97%, 97%, 2-Amino-5-fluoro-3-methoxy-benzoic acid, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 2,5g, 250mg, 1g, 5g, 10g, 50mg, 500mg.
2-amino-5-fluoro-3-methoxybenzoic acid (CAS 1250810-28-6) is a chemical compound with the molecular formula C8H8FNO3 and a molecular weight of 185.15 g/mol. IUPAC name: 2-amino-5-fluoro-3-methoxybenzoic acid. InChIKey: WCQCRQDEAFXOES-UHFFFAOYSA-N.
| Molecular formula | C8H8FNO3 |
|---|---|
| Molecular weight | 185.15 g/mol |
| IUPAC name | 2-amino-5-fluoro-3-methoxybenzoic acid |
| InChIKey | WCQCRQDEAFXOES-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1N)C(=O)O)F |
Computed by PubChem (NCBI)