CAS 1250953-77-5 is the registry number for 1-(2-Azidoethoxy)-4-iodobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-(2-azidoethoxy)-4-iodobenzene (CAS 1250953-77-5) is a chemical compound with the molecular formula C8H8IN3O and a molecular weight of 289.07 g/mol. IUPAC name: 1-(2-azidoethoxy)-4-iodobenzene. InChIKey: PVWOJDFWWVXNJQ-UHFFFAOYSA-N.
| Molecular formula | C8H8IN3O |
|---|---|
| Molecular weight | 289.07 g/mol |
| IUPAC name | 1-(2-azidoethoxy)-4-iodobenzene |
| InChIKey | PVWOJDFWWVXNJQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OCCN=[N+]=[N-])I |
Computed by PubChem (NCBI)