CAS 1250980-10-9 appears in our catalog under these names: 5'–Bromo–(1,1':3',1''–terphenyl)–4,4''–dicarboxylic acid, 5'-Bromo-[1,1':3',1''-terphenyl]-4,4''-dicarboxylic acid, 98%, 98%, 5'-Bromo-[1,1':3',1''-terphenyl]-4,4''-dicarboxylic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
4-[3-bromo-5-(4-carboxyphenyl)phenyl]benzoic acid (CAS 1250980-10-9) is a chemical compound with the molecular formula C20H13BrO4 and a molecular weight of 397.2 g/mol. IUPAC name: 4-[3-bromo-5-(4-carboxyphenyl)phenyl]benzoic acid. InChIKey: SJPCRNBUFAEKHO-UHFFFAOYSA-N.
| Molecular formula | C20H13BrO4 |
|---|---|
| Molecular weight | 397.2 g/mol |
| IUPAC name | 4-[3-bromo-5-(4-carboxyphenyl)phenyl]benzoic acid |
| InChIKey | SJPCRNBUFAEKHO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2)Br)C3=CC=C(C=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)