Products 1250991-56-0
CAS 1250991-56-0 is the registry number for rac-tert-butyl (5R,7R)-7-hydroxy-1-azaspiro[4.4]nonane-1-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Tert-butyl (5R,8R)-8-hydroxy-1-azaspiro[4.4]nonane-1-carboxylate (CAS 1250991-56-0) is a chemical compound with the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. IUPAC name: tert-butyl (5R,8R)-8-hydroxy-1-azaspiro[4.4]nonane-1-carboxylate. InChIKey: MKWIKFJAUQCTMU-ZWNOBZJWSA-N.
| Molecular formula | C13H23NO3 |
|---|---|
| Molecular weight | 241.33 g/mol |
| IUPAC name | tert-butyl (5R,8R)-8-hydroxy-1-azaspiro[4.4]nonane-1-carboxylate |
| InChIKey | MKWIKFJAUQCTMU-ZWNOBZJWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@]12CC[C@H](C2)O |
Computed by PubChem (NCBI)