Products 1251009-05-8

CAS 1251009-05-8 is the registry number for 6-Benzyl 2-tert-butyl 8-oxo-2,6,9-triazaspiro[4.5]decane-2,6-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

6-O-benzyl 2-O-tert-butyl 8-oxo-2,6,9-triazaspiro[4.5]decane-2,6-dicarboxylate (CAS 1251009-05-8) is a chemical compound with the molecular formula C20H27N3O5 and a molecular weight of 389.4 g/mol. IUPAC name: 6-O-benzyl 2-O-tert-butyl 8-oxo-2,6,9-triazaspiro[4.5]decane-2,6-dicarboxylate. InChIKey: ALYZEQUHIISTTO-UHFFFAOYSA-N.

Identity
Molecular formulaC20H27N3O5
Molecular weight389.4 g/mol
IUPAC name6-O-benzyl 2-O-tert-butyl 8-oxo-2,6,9-triazaspiro[4.5]decane-2,6-dicarboxylate
InChIKeyALYZEQUHIISTTO-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC2(C1)CNC(=O)CN2C(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)