CAS 1251021-97-2 is the registry number for cis-tert-butyl 8-bromo-3,4,4a,5-tetrahydro-1h-pyrido[4,3-b]indole-2(9bh-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Tert-butyl (4aS,9bR)-8-bromo-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole-2-carboxylate (CAS 1251021-97-2) is a chemical compound with the molecular formula C16H21BrN2O2 and a molecular weight of 353.25 g/mol. IUPAC name: tert-butyl (4aS,9bR)-8-bromo-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole-2-carboxylate. InChIKey: YMSAVEMRGDWREM-JSGCOSHPSA-N.
| Molecular formula | C16H21BrN2O2 |
|---|---|
| Molecular weight | 353.25 g/mol |
| IUPAC name | tert-butyl (4aS,9bR)-8-bromo-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole-2-carboxylate |
| InChIKey | YMSAVEMRGDWREM-JSGCOSHPSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]2[C@@H](C1)C3=C(N2)C=CC(=C3)Br |
Computed by PubChem (NCBI)