Products 125109-42-4
CAS 125109-42-4 is the registry number for L-Alanine-2,3,3,3-d4 Methyl Ester Hydrochloric Acid Salt. Offered by: TRC. Available pack sizes: 5mg.
Methyl (2S)-2-amino-2,3,3,3-tetradeuteriopropanoate;hydrochloride (CAS 125109-42-4) is a chemical compound with the molecular formula C4H10ClNO2 and a molecular weight of 143.60 g/mol. IUPAC name: methyl (2S)-2-amino-2,3,3,3-tetradeuteriopropanoate;hydrochloride. InChIKey: IYUKFAFDFHZKPI-BVWQQZMUSA-N.
| Molecular formula | C4H10ClNO2 |
|---|---|
| Molecular weight | 143.60 g/mol |
| IUPAC name | methyl (2S)-2-amino-2,3,3,3-tetradeuteriopropanoate;hydrochloride |
| InChIKey | IYUKFAFDFHZKPI-BVWQQZMUSA-N |
| SMILES | [2H][C@@](C(=O)OC)(C([2H])([2H])[2H])N.Cl |
Computed by PubChem (NCBI)