CAS 1251195-14-8 is the registry number for 6-(Aminomethyl)isoindolin-1-one. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
6-(aminomethyl)-2,3-dihydroisoindol-1-one (CAS 1251195-14-8) is a chemical compound with the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. IUPAC name: 6-(aminomethyl)-2,3-dihydroisoindol-1-one. InChIKey: SWVACKJYWYOGRE-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O |
|---|---|
| Molecular weight | 162.19 g/mol |
| IUPAC name | 6-(aminomethyl)-2,3-dihydroisoindol-1-one |
| InChIKey | SWVACKJYWYOGRE-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2)CN)C(=O)N1 |
Computed by PubChem (NCBI)