CAS 125143-53-5 appears in our catalog under these names: 3,3',5,5'–Tetrabromo–2,2'–bithiophene, 3,3',5,5'-Tetrabromo-2,2'-bithiophene, >98.0%(GC), 3,3',5,5'-Tetrabromo-2,2'-bithiophene, 98%, 98%, 3,3',5,5'-Tetrabromo-2,2'-bithiophene, 98%, 3,3',5,5'-Tetrabromo-2,2'-bithiophene, 98% (stabilized with Cu+HQ+MgO). Offered by: GLPBio, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 1g, 10g, 100g.
3,5-dibromo-2-(3,5-dibromothiophen-2-yl)thiophene (CAS 125143-53-5) is a chemical compound with the molecular formula C8H2Br4S2 and a molecular weight of 481.9 g/mol. IUPAC name: 3,5-dibromo-2-(3,5-dibromothiophen-2-yl)thiophene. InChIKey: MOMHMPZSZNZLAK-UHFFFAOYSA-N.
| Molecular formula | C8H2Br4S2 |
|---|---|
| Molecular weight | 481.9 g/mol |
| IUPAC name | 3,5-dibromo-2-(3,5-dibromothiophen-2-yl)thiophene |
| InChIKey | MOMHMPZSZNZLAK-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1Br)C2=C(C=C(S2)Br)Br)Br |
Computed by PubChem (NCBI)