Products 1251474-62-0
CAS 1251474-62-0 is the registry number for 3-(2-Methoxyphenyl)but-2-enenitrile, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
(E)-3-(2-methoxyphenyl)but-2-enenitrile (CAS 1251474-62-0) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: (E)-3-(2-methoxyphenyl)but-2-enenitrile. InChIKey: ZBPWJWXDCUFULS-VQHVLOKHSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | (E)-3-(2-methoxyphenyl)but-2-enenitrile |
| InChIKey | ZBPWJWXDCUFULS-VQHVLOKHSA-N |
| SMILES | C/C(=C\C#N)/C1=CC=CC=C1OC |
Computed by PubChem (NCBI)