CAS 1251503-35-1 appears in our catalog under these names: 8-[2-(2-Pyridyl)phenyl]-5h-pyrido[3,2-b]indole, 95%, 8–(2–(2–Pyridyl)phenyl)–5H–pyrido(3,2–b)indole, 8-[2-(2-Pyridyl)phenyl]-5H-pyrido[3,2-b]indole, >98.0%(GC), 8-[2-(2-Pyridyl)phenyl]-5H-pyrido[3,2-b]indole. Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 100mg, 10mg.
8-(2-pyridin-2-ylphenyl)-5H-pyrido[3,2-b]indole (CAS 1251503-35-1) is a chemical compound with the molecular formula C22H15N3 and a molecular weight of 321.4 g/mol. IUPAC name: 8-(2-pyridin-2-ylphenyl)-5H-pyrido[3,2-b]indole. InChIKey: ROQWGQBJRGUPAG-UHFFFAOYSA-N.
| Molecular formula | C22H15N3 |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | 8-(2-pyridin-2-ylphenyl)-5H-pyrido[3,2-b]indole |
| InChIKey | ROQWGQBJRGUPAG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC3=C(C=C2)NC4=C3N=CC=C4)C5=CC=CC=N5 |
Computed by PubChem (NCBI)