CAS 1251744-77-0 is the registry number for 2-​(4-​(Diethylamino)​phenyl)​-​3,​6-​dimethyl-benzothiazolium chloride. Offered by: Biosynth. Available pack sizes: 50mg, 5mg, 10mg, 25mg, 100mg.
4-(3,6-dimethyl-1,3-benzothiazol-3-ium-2-yl)-N,N-diethylaniline chloride (CAS 1251744-77-0) is a chemical compound with the molecular formula C19H23ClN2S and a molecular weight of 346.9 g/mol. IUPAC name: 4-(3,6-dimethyl-1,3-benzothiazol-3-ium-2-yl)-N,N-diethylaniline chloride. InChIKey: QPFBUDUSRXHRCB-UHFFFAOYSA-M.
| Molecular formula | C19H23ClN2S |
|---|---|
| Molecular weight | 346.9 g/mol |
| IUPAC name | 4-(3,6-dimethyl-1,3-benzothiazol-3-ium-2-yl)-N,N-diethylaniline chloride |
| InChIKey | QPFBUDUSRXHRCB-UHFFFAOYSA-M |
| SMILES | CCN(CC)C1=CC=C(C=C1)C2=[N+](C3=C(S2)C=C(C=C3)C)C.[Cl-] |
Computed by PubChem (NCBI)