CAS 1251825-65-6 is the registry number for (4,6-Diphenyl-1,3,5-triazin-2-yl)boronic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(4,6-diphenyl-1,3,5-triazin-2-yl)boronic acid (CAS 1251825-65-6) is a chemical compound with the molecular formula C15H12BN3O2 and a molecular weight of 277.09 g/mol. IUPAC name: (4,6-diphenyl-1,3,5-triazin-2-yl)boronic acid. InChIKey: ISTQSZJUYOCTMJ-UHFFFAOYSA-N.
| Molecular formula | C15H12BN3O2 |
|---|---|
| Molecular weight | 277.09 g/mol |
| IUPAC name | (4,6-diphenyl-1,3,5-triazin-2-yl)boronic acid |
| InChIKey | ISTQSZJUYOCTMJ-UHFFFAOYSA-N |
| SMILES | B(C1=NC(=NC(=N1)C2=CC=CC=C2)C3=CC=CC=C3)(O)O |
Computed by PubChem (NCBI)