CAS 1251922-62-9 appears in our catalog under these names: 2-(5,6-Difluoro-1H-1,3-benzodiazol-1-yl)-3-methylbutanoic acid hydrochloride, 95%, 2-(5,6-Difluoro-1H-1,3-benzodiazol-1-yl)-3-methylbutanoic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-(5,6-difluorobenzimidazol-1-yl)-3-methylbutanoic acid;hydrochloride (CAS 1251922-62-9) is a chemical compound with the molecular formula C12H13ClF2N2O2 and a molecular weight of 290.69 g/mol. IUPAC name: 2-(5,6-difluorobenzimidazol-1-yl)-3-methylbutanoic acid;hydrochloride. InChIKey: KPTZDEQEFLLOFY-UHFFFAOYSA-N.
| Molecular formula | C12H13ClF2N2O2 |
|---|---|
| Molecular weight | 290.69 g/mol |
| IUPAC name | 2-(5,6-difluorobenzimidazol-1-yl)-3-methylbutanoic acid;hydrochloride |
| InChIKey | KPTZDEQEFLLOFY-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)O)N1C=NC2=CC(=C(C=C21)F)F.Cl |
Computed by PubChem (NCBI)