CAS 1251922-86-7 appears in our catalog under these names: 2-Fluoro-5-methyl-n-[1-(4-methylphenyl)ethyl]aniline hydrochloride, 95%, 2-Fluoro-5-methyl-N-(1-(4-methylphenyl)ethyl)aniline hydrochloride, 95%, 2-Fluoro-5-methyl-N-(1-(4-methylphenyl)ethyl)aniline hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
2-fluoro-5-methyl-N-[1-(4-methylphenyl)ethyl]aniline;hydrochloride (CAS 1251922-86-7) is a chemical compound with the molecular formula C16H19ClFN and a molecular weight of 279.78 g/mol. IUPAC name: 2-fluoro-5-methyl-N-[1-(4-methylphenyl)ethyl]aniline;hydrochloride. InChIKey: DTMDXFYXCGZFBR-UHFFFAOYSA-N.
| Molecular formula | C16H19ClFN |
|---|---|
| Molecular weight | 279.78 g/mol |
| IUPAC name | 2-fluoro-5-methyl-N-[1-(4-methylphenyl)ethyl]aniline;hydrochloride |
| InChIKey | DTMDXFYXCGZFBR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C)NC2=C(C=CC(=C2)C)F.Cl |
Computed by PubChem (NCBI)