CAS 1251923-57-5 appears in our catalog under these names: 2-(4-Fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-one, 95%, 2-(4-Fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
2-(4-fluorophenyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one (CAS 1251923-57-5) is a chemical compound with the molecular formula C13H10FNOS and a molecular weight of 247.29 g/mol. IUPAC name: 2-(4-fluorophenyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one. InChIKey: RYKWWGXGOXTIJV-UHFFFAOYSA-N.
| Molecular formula | C13H10FNOS |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one |
| InChIKey | RYKWWGXGOXTIJV-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)C1)SC(=N2)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)