CAS 1251923-63-3 appears in our catalog under these names: 2-Amino-1-[4-(pyrazin-2-yl)piperazin-1-yl]propan-1-one dihydrochloride, 98%, 2-Amino-1-(4-(pyrazin-2-yl)piperazin-1-yl)propan-1-one dihydrochloride. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 50mg, 0,5g.
2-amino-1-(4-pyrazin-2-ylpiperazin-1-yl)propan-1-one;dihydrochloride (CAS 1251923-63-3) is a chemical compound with the molecular formula C11H19Cl2N5O and a molecular weight of 308.20 g/mol. IUPAC name: 2-amino-1-(4-pyrazin-2-ylpiperazin-1-yl)propan-1-one;dihydrochloride. InChIKey: USRGIBCLRRBARP-UHFFFAOYSA-N.
| Molecular formula | C11H19Cl2N5O |
|---|---|
| Molecular weight | 308.20 g/mol |
| IUPAC name | 2-amino-1-(4-pyrazin-2-ylpiperazin-1-yl)propan-1-one;dihydrochloride |
| InChIKey | USRGIBCLRRBARP-UHFFFAOYSA-N |
| SMILES | CC(C(=O)N1CCN(CC1)C2=NC=CN=C2)N.Cl.Cl |
Computed by PubChem (NCBI)