CAS 1251924-42-1 is the registry number for (4-Methoxy-3-nitrophenyl)methanesulfonyl fluoride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(4-methoxy-3-nitrophenyl)methanesulfonyl fluoride (CAS 1251924-42-1) is a chemical compound with the molecular formula C8H8FNO5S and a molecular weight of 249.22 g/mol. IUPAC name: (4-methoxy-3-nitrophenyl)methanesulfonyl fluoride. InChIKey: VNLNWBAJFFMVEM-UHFFFAOYSA-N.
| Molecular formula | C8H8FNO5S |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | (4-methoxy-3-nitrophenyl)methanesulfonyl fluoride |
| InChIKey | VNLNWBAJFFMVEM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CS(=O)(=O)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)