CAS 1251924-46-5 appears in our catalog under these names: Sodium 2-(4-(trifluoromethyl)-1,3-thiazol-2-yl)acetate, 95%, Sodium 2-(4-(trifluoromethyl)-1,3-thiazol-2-yl)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 50mg, 0,5g.
Sodium 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]acetate (CAS 1251924-46-5) is a chemical compound with the molecular formula C6H3F3NNaO2S and a molecular weight of 233.15 g/mol. IUPAC name: sodium 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]acetate. InChIKey: UCKNFYUUHVFZAI-UHFFFAOYSA-M.
| Molecular formula | C6H3F3NNaO2S |
|---|---|
| Molecular weight | 233.15 g/mol |
| IUPAC name | sodium 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]acetate |
| InChIKey | UCKNFYUUHVFZAI-UHFFFAOYSA-M |
| SMILES | C1=C(N=C(S1)CC(=O)[O-])C(F)(F)F.[Na+] |
Computed by PubChem (NCBI)