Products 1251924-67-0
CAS 1251924-67-0 appears in our catalog under these names: Silodosin Impurity 32, 2-(2-(2,2,2-Trifluoroethoxy)phenoxy)acetic acid, 95%, 2-(2-(2,2,2-Trifluoroethoxy)phenoxy)acetic acid. Offered by: Chemat Brand, AmBeed, Biosynth. Available pack sizes: on request, 5g, 250mg, 2,5g.
2-[2-(2,2,2-trifluoroethoxy)phenoxy]acetic acid (CAS 1251924-67-0) is a chemical compound with the molecular formula C10H9F3O4 and a molecular weight of 250.17 g/mol. IUPAC name: 2-[2-(2,2,2-trifluoroethoxy)phenoxy]acetic acid. InChIKey: NIZSYZSAZKLYJR-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O4 |
|---|---|
| Molecular weight | 250.17 g/mol |
| IUPAC name | 2-[2-(2,2,2-trifluoroethoxy)phenoxy]acetic acid |
| InChIKey | NIZSYZSAZKLYJR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OCC(=O)O)OCC(F)(F)F |
Computed by PubChem (NCBI)